C37H54N2O4 — CID 134942834
[1-hex-5-enyl-4-[(3R)-3-hex-5-enyl-2-oxo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-5-yl]-3,6-dihydro-2H-pyridin-5-yl]methyl acetate (PubChem CID 134942834) has the molecular formula C37H54N2O4 and a molecular weight of 590.85 g/mol. Its IUPAC name is [1-hex-5-enyl-4-[(3R)-3-hex-5-enyl-2-oxo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-5-yl]-3,6-dihydro-2H-pyridin-5-yl]methyl acetate.
| Compound Name | [1-hex-5-enyl-4-[(3R)-3-hex-5-enyl-2-oxo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-5-yl]-3,6-dihydro-2H-pyridin-5-yl]methyl acetate |
|---|---|
| PubChem CID | 134942834 |
| Molecular Formula | C37H54N2O4 |
| Molecular Weight | 590.85 g/mol |
| Exact Mass | 590.41 |
| IUPAC Name | [1-hex-5-enyl-4-[(3R)-3-hex-5-enyl-2-oxo-1-(5-phenylmethoxypentyl)-3,4-dihydropyridin-5-yl]-3,6-dihydro-2H-pyridin-5-yl]methyl acetate |
| SMILES | C=CCCCC[C@@H]1CC(C2=C(COC(C)=O)CN(CCCCC=C)CC2)=CN(CCCCCOCc2ccccc2)C1=O |
| InChI | InChI=1S/C37H54N2O4/c1-4-6-8-14-20-33-26-34(36-21-24-38(22-15-9-7-5-2)27-35(36)30-43-31(3)40)28-39(37(33)41)23-16-11-17-25-42-29-32-18-12-10-13-19-32/h4-5,10,12-13,18-19,28,33H,1-2,6-9,11,14-17,20-27,29-30H2,3H3/t33-/m1/s1 |
| InChIKey | JWRYGMUZMZGZAK-MGBGTMOVSA-N |
| XLogP | 7.77 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.85 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|