C30H49NO3 — CID 58246702
(3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-3-ethoxypropoxy(phenyl)methyl]piperidin-1-yl]hexan-1-one (PubChem CID 58246702) has the molecular formula C30H49NO3 and a molecular weight of 471.73 g/mol. Its IUPAC name is (3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-3-ethoxypropoxy(phenyl)methyl]piperidin-1-yl]hexan-1-one.
| Compound Name | (3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-3-ethoxypropoxy(phenyl)methyl]piperidin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 58246702 |
| Molecular Formula | C30H49NO3 |
| Molecular Weight | 471.73 g/mol |
| Exact Mass | 471.37 |
| IUPAC Name | (3R)-3-(cyclohexylmethyl)-1-[(3R)-3-[(R)-3-ethoxypropoxy(phenyl)methyl]piperidin-1-yl]hexan-1-one |
| SMILES | CCC[C@@H](CC(=O)N1CCC[C@@H]([C@@H](OCCCOCC)c2ccccc2)C1)CC1CCCCC1 |
| InChI | InChI=1S/C30H49NO3/c1-3-13-26(22-25-14-7-5-8-15-25)23-29(32)31-19-11-18-28(24-31)30(27-16-9-6-10-17-27)34-21-12-20-33-4-2/h6,9-10,16-17,25-26,28,30H,3-5,7-8,11-15,18-24H2,1-2H3/t26-,28-,30+/m1/s1 |
| InChIKey | LOUGGHOMQAXCNW-GFKSZRKTSA-N |
| XLogP | 7.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.73 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|