C20H25NO — CID 3064296
4-benzhydryloxy-1,3-dimethylpiperidine (PubChem CID 3064296) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-benzhydryloxy-1,3-dimethylpiperidine.
| Compound Name | 4-benzhydryloxy-1,3-dimethylpiperidine |
|---|---|
| PubChem CID | 3064296 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-benzhydryloxy-1,3-dimethylpiperidine |
| SMILES | CC1CN(C)CCC1OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H25NO/c1-16-15-21(2)14-13-19(16)22-20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,16,19-20H,13-15H2,1-2H3 |
| InChIKey | WLZDZBCIJSHZCN-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |