C12H18F3N3O — CID 134847042
N-hexyl-3-methyl-5-(trifluoromethyl)pyrazole-1-carboxamide (PubChem CID 134847042) has the molecular formula C12H18F3N3O and a molecular weight of 277.29 g/mol. Its IUPAC name is N-hexyl-3-methyl-5-(trifluoromethyl)pyrazole-1-carboxamide.
| Compound Name | N-hexyl-3-methyl-5-(trifluoromethyl)pyrazole-1-carboxamide |
|---|---|
| PubChem CID | 134847042 |
| Molecular Formula | C12H18F3N3O |
| Molecular Weight | 277.29 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | N-hexyl-3-methyl-5-(trifluoromethyl)pyrazole-1-carboxamide |
| SMILES | CCCCCCNC(=O)n1nc(C)cc1C(F)(F)F |
| InChI | InChI=1S/C12H18F3N3O/c1-3-4-5-6-7-16-11(19)18-10(12(13,14)15)8-9(2)17-18/h8H,3-7H2,1-2H3,(H,16,19) |
| InChIKey | OSGDWQSARVBUOD-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|