C26H25FN+ — CID 134847045
2-[fluoro(diphenyl)methyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium (PubChem CID 134847045) has the molecular formula C26H25FN+ and a molecular weight of 370.49 g/mol. Its IUPAC name is 2-[fluoro(diphenyl)methyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium.
| Compound Name | 2-[fluoro(diphenyl)methyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 134847045 |
| Molecular Formula | C26H25FN+ |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 2-[fluoro(diphenyl)methyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium |
| SMILES | FC(c1ccccc1)(c1ccccc1)C1CCC/[N+]1=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C26H25FN/c27-26(23-15-6-2-7-16-23,24-17-8-3-9-18-24)25-19-11-21-28(25)20-10-14-22-12-4-1-5-13-22/h1-10,12-18,20,25H,11,19,21H2/q+1/b14-10+,28-20+ |
| InChIKey | WGASSDYKIFNPOT-KFBANQBHSA-N |
| XLogP | 5.86 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|