C27H26F2N+ — CID 135029429
(2S)-2-[(1R)-1,2-difluoro-2,2-diphenylethyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium (PubChem CID 135029429) has the molecular formula C27H26F2N+ and a molecular weight of 402.51 g/mol. Its IUPAC name is (2S)-2-[(1R)-1,2-difluoro-2,2-diphenylethyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium.
| Compound Name | (2S)-2-[(1R)-1,2-difluoro-2,2-diphenylethyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 135029429 |
| Molecular Formula | C27H26F2N+ |
| Molecular Weight | 402.51 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | (2S)-2-[(1R)-1,2-difluoro-2,2-diphenylethyl]-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium |
| SMILES | F[C@H]([C@@H]1CCC/[N+]1=C\C=C\c1ccccc1)C(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26F2N/c28-26(25-19-11-21-30(25)20-10-14-22-12-4-1-5-13-22)27(29,23-15-6-2-7-16-23)24-17-8-3-9-18-24/h1-10,12-18,20,25-26H,11,19,21H2/q+1/b14-10+,30-20+/t25-,26+/m0/s1 |
| InChIKey | YLAUBSNAGLHBSM-LPBWGJOKSA-N |
| XLogP | 6.20 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|