C14H16F2N+ — CID 162403189
(2R)-4,4-difluoro-2-methyl-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium (PubChem CID 162403189) has the molecular formula C14H16F2N+ and a molecular weight of 236.29 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-methyl-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium.
| Compound Name | (2R)-4,4-difluoro-2-methyl-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 162403189 |
| Molecular Formula | C14H16F2N+ |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | (2R)-4,4-difluoro-2-methyl-1-[(E)-3-phenylprop-2-enylidene]pyrrolidin-1-ium |
| SMILES | C[C@@H]1CC(F)(F)C/[N+]1=C\C=C\c1ccccc1 |
| InChI | InChI=1S/C14H16F2N/c1-12-10-14(15,16)11-17(12)9-5-8-13-6-3-2-4-7-13/h2-9,12H,10-11H2,1H3/q+1/b8-5+,17-9+/t12-/m1/s1 |
| InChIKey | KAFVORAKWPMRFQ-AQTUGMMDSA-N |
| XLogP | 3.21 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|