C14H15F9NP — CID 139045290
(2R)-1-[(E)-3-phenylprop-2-enylidene]-2-(trifluoromethyl)pyrrolidin-1-ium hexafluorophosphate (PubChem CID 139045290) has the molecular formula C14H15F9NP and a molecular weight of 399.24 g/mol. Its IUPAC name is (2R)-1-[(E)-3-phenylprop-2-enylidene]-2-(trifluoromethyl)pyrrolidin-1-ium hexafluorophosphate.
| Compound Name | (2R)-1-[(E)-3-phenylprop-2-enylidene]-2-(trifluoromethyl)pyrrolidin-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 139045290 |
| Molecular Formula | C14H15F9NP |
| Molecular Weight | 399.24 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | (2R)-1-[(E)-3-phenylprop-2-enylidene]-2-(trifluoromethyl)pyrrolidin-1-ium hexafluorophosphate |
| SMILES | FC(F)(F)[C@H]1CCC/[N+]1=C\C=C\c1ccccc1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C14H15F3N.F6P/c15-14(16,17)13-9-5-11-18(13)10-4-8-12-6-2-1-3-7-12;1-7(2,3,4,5)6/h1-4,6-8,10,13H,5,9,11H2;/q+1;-1/b8-4+,18-10+;/t13-;/m1./s1 |
| InChIKey | JBJYBZNKFBAITK-LXCCHRGDSA-N |
| XLogP | 6.89 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.24 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|