C27H27F3N+ — CID 90796123
benzylidene-[1-(5,6-dimethylidenecyclohexa-1,3-dien-1-yl)ethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium (PubChem CID 90796123) has the molecular formula C27H27F3N+ and a molecular weight of 422.51 g/mol. Its IUPAC name is benzylidene-[1-(5,6-dimethylidenecyclohexa-1,3-dien-1-yl)ethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium.
| Compound Name | benzylidene-[1-(5,6-dimethylidenecyclohexa-1,3-dien-1-yl)ethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium |
|---|---|
| PubChem CID | 90796123 |
| Molecular Formula | C27H27F3N+ |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | benzylidene-[1-(5,6-dimethylidenecyclohexa-1,3-dien-1-yl)ethyl]-[3-[3-(trifluoromethyl)phenyl]propyl]azanium |
| SMILES | C=c1cccc(C(C)/[N+](=C/c2ccccc2)CCCc2cccc(C(F)(F)F)c2)c1=C |
| InChI | InChI=1S/C27H27F3N/c1-20-10-7-16-26(21(20)2)22(3)31(19-24-11-5-4-6-12-24)17-9-14-23-13-8-15-25(18-23)27(28,29)30/h4-8,10-13,15-16,18-19,22H,1-2,9,14,17H2,3H3/q+1/b31-19+ |
| InChIKey | ONHZURSNJSPWJC-ZCTHSVRISA-N |
| XLogP | 5.35 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|