C18H26FN — CID 135011598
(2S,3R,4S,5S)-2-cyclohexyl-3-fluoro-1,5-dimethyl-4-phenylpyrrolidine (PubChem CID 135011598) has the molecular formula C18H26FN and a molecular weight of 275.41 g/mol. Its IUPAC name is (2S,3R,4S,5S)-2-cyclohexyl-3-fluoro-1,5-dimethyl-4-phenylpyrrolidine.
| Compound Name | (2S,3R,4S,5S)-2-cyclohexyl-3-fluoro-1,5-dimethyl-4-phenylpyrrolidine |
|---|---|
| PubChem CID | 135011598 |
| Molecular Formula | C18H26FN |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | (2S,3R,4S,5S)-2-cyclohexyl-3-fluoro-1,5-dimethyl-4-phenylpyrrolidine |
| SMILES | C[C@H]1[C@H](c2ccccc2)[C@@H](F)[C@H](C2CCCCC2)N1C |
| InChI | InChI=1S/C18H26FN/c1-13-16(14-9-5-3-6-10-14)17(19)18(20(13)2)15-11-7-4-8-12-15/h3,5-6,9-10,13,15-18H,4,7-8,11-12H2,1-2H3/t13-,16+,17+,18-/m0/s1 |
| InChIKey | SMQCSYYGGJWHGY-LIRZEXBASA-N |
| XLogP | 4.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |