C25H32O5 — CID 134847424
diethyl (3S,7aS)-1,1-dimethyl-3-phenyl-4-prop-1-en-2-yl-3,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate (PubChem CID 134847424) has the molecular formula C25H32O5 and a molecular weight of 412.53 g/mol. Its IUPAC name is diethyl (3S,7aS)-1,1-dimethyl-3-phenyl-4-prop-1-en-2-yl-3,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate.
| Compound Name | diethyl (3S,7aS)-1,1-dimethyl-3-phenyl-4-prop-1-en-2-yl-3,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
|---|---|
| PubChem CID | 134847424 |
| Molecular Formula | C25H32O5 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | diethyl (3S,7aS)-1,1-dimethyl-3-phenyl-4-prop-1-en-2-yl-3,5,7,7a-tetrahydrocyclopenta[c]pyran-6,6-dicarboxylate |
| SMILES | C=C(C)C1=C2CC(C(=O)OCC)(C(=O)OCC)C[C@@H]2C(C)(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H32O5/c1-7-28-22(26)25(23(27)29-8-2)14-18-19(15-25)24(5,6)30-21(20(18)16(3)4)17-12-10-9-11-13-17/h9-13,19,21H,3,7-8,14-15H2,1-2,4-6H3/t19-,21-/m0/s1 |
| InChIKey | JNZOWZTZBVFONM-FPOVZHCZSA-N |
| XLogP | 4.93 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|