C26H33NO7S — CID 134847758
benzyl (3aS,6S,6aS)-2,2-diethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate (PubChem CID 134847758) has the molecular formula C26H33NO7S and a molecular weight of 503.62 g/mol. Its IUPAC name is benzyl (3aS,6S,6aS)-2,2-diethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate.
| Compound Name | benzyl (3aS,6S,6aS)-2,2-diethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate |
|---|---|
| PubChem CID | 134847758 |
| Molecular Formula | C26H33NO7S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | benzyl (3aS,6S,6aS)-2,2-diethyl-6-[2-(4-methylphenyl)sulfonyloxyethyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]oxazole-3-carboxylate |
| SMILES | CCC1(CC)O[C@@H]2[C@H](CCOS(=O)(=O)c3ccc(C)cc3)OC[C@@H]2N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H33NO7S/c1-4-26(5-2)27(25(28)32-17-20-9-7-6-8-10-20)22-18-31-23(24(22)34-26)15-16-33-35(29,30)21-13-11-19(3)12-14-21/h6-14,22-24H,4-5,15-18H2,1-3H3/t22-,23-,24-/m0/s1 |
| InChIKey | HFBSFCBSQKPKRD-HJOGWXRNSA-N |
| XLogP | 4.41 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|