C36H38N2O5S — CID 134848376
ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-5-methoxy-2-oxo-1-tritylindol-3-yl]acetate (PubChem CID 134848376) has the molecular formula C36H38N2O5S and a molecular weight of 610.78 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-5-methoxy-2-oxo-1-tritylindol-3-yl]acetate.
| Compound Name | ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-5-methoxy-2-oxo-1-tritylindol-3-yl]acetate |
|---|---|
| PubChem CID | 134848376 |
| Molecular Formula | C36H38N2O5S |
| Molecular Weight | 610.78 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-5-methoxy-2-oxo-1-tritylindol-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(N[S@](=O)C(C)(C)C)C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(OC)cc21 |
| InChI | InChI=1S/C36H38N2O5S/c1-6-43-32(39)25-35(37-44(41)34(2,3)4)30-24-29(42-5)22-23-31(30)38(33(35)40)36(26-16-10-7-11-17-26,27-18-12-8-13-19-27)28-20-14-9-15-21-28/h7-24,37H,6,25H2,1-5H3/t35-,44+/m0/s1 |
| InChIKey | CRMIRRMLNGDQBU-PSLXYLBZSA-N |
| XLogP | 6.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.78 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|