C35H35FN2O4S — CID 134848412
ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-7-fluoro-2-oxo-1-tritylindol-3-yl]acetate (PubChem CID 134848412) has the molecular formula C35H35FN2O4S and a molecular weight of 598.74 g/mol. Its IUPAC name is ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-7-fluoro-2-oxo-1-tritylindol-3-yl]acetate.
| Compound Name | ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-7-fluoro-2-oxo-1-tritylindol-3-yl]acetate |
|---|---|
| PubChem CID | 134848412 |
| Molecular Formula | C35H35FN2O4S |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | ethyl 2-[(3S)-3-[[(R)-tert-butylsulfinyl]amino]-7-fluoro-2-oxo-1-tritylindol-3-yl]acetate |
| SMILES | CCOC(=O)C[C@@]1(N[S@](=O)C(C)(C)C)C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2c(F)cccc21 |
| InChI | InChI=1S/C35H35FN2O4S/c1-5-42-30(39)24-34(37-43(41)33(2,3)4)28-22-15-23-29(36)31(28)38(32(34)40)35(25-16-9-6-10-17-25,26-18-11-7-12-19-26)27-20-13-8-14-21-27/h6-23,37H,5,24H2,1-4H3/t34-,43+/m0/s1 |
| InChIKey | XSTHNWCYTQSIOM-PSBPOGMQSA-N |
| XLogP | 6.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|