C36H34N2O4S — CID 102223607
2-methyl-N-[(3R)-3-[(2R)-3-methyl-5-oxo-2H-furan-2-yl]-2-oxo-1-tritylindol-3-yl]propane-2-sulfinamide (PubChem CID 102223607) has the molecular formula C36H34N2O4S and a molecular weight of 590.75 g/mol. Its IUPAC name is 2-methyl-N-[(3R)-3-[(2R)-3-methyl-5-oxo-2H-furan-2-yl]-2-oxo-1-tritylindol-3-yl]propane-2-sulfinamide.
| Compound Name | 2-methyl-N-[(3R)-3-[(2R)-3-methyl-5-oxo-2H-furan-2-yl]-2-oxo-1-tritylindol-3-yl]propane-2-sulfinamide |
|---|---|
| PubChem CID | 102223607 |
| Molecular Formula | C36H34N2O4S |
| Molecular Weight | 590.75 g/mol |
| Exact Mass | 590.22 |
| IUPAC Name | 2-methyl-N-[(3R)-3-[(2R)-3-methyl-5-oxo-2H-furan-2-yl]-2-oxo-1-tritylindol-3-yl]propane-2-sulfinamide |
| SMILES | CC1=CC(=O)O[C@H]1[C@@]1(NS(=O)C(C)(C)C)C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C36H34N2O4S/c1-25-24-31(39)42-32(25)35(37-43(41)34(2,3)4)29-22-14-15-23-30(29)38(33(35)40)36(26-16-8-5-9-17-26,27-18-10-6-11-19-27)28-20-12-7-13-21-28/h5-24,32,37H,1-4H3/t32-,35-,43?/m1/s1 |
| InChIKey | JJHZGZKJFGCYJX-AYCJPABSSA-N |
| XLogP | 6.14 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.75 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|