C31H23NO3 — CID 56963952
1'-tritylspiro[3H-pyran-2,3'-indole]-2',4-dione (PubChem CID 56963952) has the molecular formula C31H23NO3 and a molecular weight of 457.53 g/mol. Its IUPAC name is 1'-tritylspiro[3H-pyran-2,3'-indole]-2',4-dione.
| Compound Name | 1'-tritylspiro[3H-pyran-2,3'-indole]-2',4-dione |
|---|---|
| PubChem CID | 56963952 |
| Molecular Formula | C31H23NO3 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 1'-tritylspiro[3H-pyran-2,3'-indole]-2',4-dione |
| SMILES | O=C1C=COC2(C1)C(=O)N(C(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc12 |
| InChI | InChI=1S/C31H23NO3/c33-26-20-21-35-30(22-26)27-18-10-11-19-28(27)32(29(30)34)31(23-12-4-1-5-13-23,24-14-6-2-7-15-24)25-16-8-3-9-17-25/h1-21H,22H2 |
| InChIKey | FDSBJAOZLYQFPO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|