C32H29NO3 — CID 138964758
(3R)-3-hydroxy-3-(3-methylbutanoyl)-1-tritylindol-2-one (PubChem CID 138964758) has the molecular formula C32H29NO3 and a molecular weight of 475.59 g/mol. Its IUPAC name is (3R)-3-hydroxy-3-(3-methylbutanoyl)-1-tritylindol-2-one.
| Compound Name | (3R)-3-hydroxy-3-(3-methylbutanoyl)-1-tritylindol-2-one |
|---|---|
| PubChem CID | 138964758 |
| Molecular Formula | C32H29NO3 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | (3R)-3-hydroxy-3-(3-methylbutanoyl)-1-tritylindol-2-one |
| SMILES | CC(C)CC(=O)[C@@]1(O)C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C32H29NO3/c1-23(2)22-29(34)32(36)27-20-12-13-21-28(27)33(30(32)35)31(24-14-6-3-7-15-24,25-16-8-4-9-17-25)26-18-10-5-11-19-26/h3-21,23,36H,22H2,1-2H3/t32-/m1/s1 |
| InChIKey | DZSTZDGSNCZAGJ-JGCGQSQUSA-N |
| XLogP | 5.83 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|