C37H36N2O4S — CID 139041849
(R)-N-[(3R)-3-[(2R)-2,4-dimethyl-5-oxofuran-2-yl]-2-oxo-1-tritylindol-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 139041849) has the molecular formula C37H36N2O4S and a molecular weight of 604.77 g/mol. Its IUPAC name is (R)-N-[(3R)-3-[(2R)-2,4-dimethyl-5-oxofuran-2-yl]-2-oxo-1-tritylindol-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(3R)-3-[(2R)-2,4-dimethyl-5-oxofuran-2-yl]-2-oxo-1-tritylindol-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 139041849 |
| Molecular Formula | C37H36N2O4S |
| Molecular Weight | 604.77 g/mol |
| Exact Mass | 604.24 |
| IUPAC Name | (R)-N-[(3R)-3-[(2R)-2,4-dimethyl-5-oxofuran-2-yl]-2-oxo-1-tritylindol-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | CC1=C[C@](C)([C@@]2(N[S@](=O)C(C)(C)C)C(=O)N(C(c3ccccc3)(c3ccccc3)c3ccccc3)c3ccccc32)OC1=O |
| InChI | InChI=1S/C37H36N2O4S/c1-26-25-35(5,43-32(26)40)37(38-44(42)34(2,3)4)30-23-15-16-24-31(30)39(33(37)41)36(27-17-9-6-10-18-27,28-19-11-7-12-20-28)29-21-13-8-14-22-29/h6-25,38H,1-5H3/t35-,37+,44-/m1/s1 |
| InChIKey | HLWUBFWXZONXES-VDCFVHECSA-N |
| XLogP | 6.53 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.77 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|