C36H26ClNO3 — CID 132533710
(3R,4'S)-5-chloro-4'-phenyl-1-tritylspiro[indole-3,5'-oxolane]-2,2'-dione (PubChem CID 132533710) has the molecular formula C36H26ClNO3 and a molecular weight of 556.06 g/mol. Its IUPAC name is (3R,4'S)-5-chloro-4'-phenyl-1-tritylspiro[indole-3,5'-oxolane]-2,2'-dione.
| Compound Name | (3R,4'S)-5-chloro-4'-phenyl-1-tritylspiro[indole-3,5'-oxolane]-2,2'-dione |
|---|---|
| PubChem CID | 132533710 |
| Molecular Formula | C36H26ClNO3 |
| Molecular Weight | 556.06 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | (3R,4'S)-5-chloro-4'-phenyl-1-tritylspiro[indole-3,5'-oxolane]-2,2'-dione |
| SMILES | O=C1C[C@@H](c2ccccc2)[C@]2(O1)C(=O)N(C(c1ccccc1)(c1ccccc1)c1ccccc1)c1ccc(Cl)cc12 |
| InChI | InChI=1S/C36H26ClNO3/c37-29-21-22-32-31(23-29)36(30(24-33(39)41-36)25-13-5-1-6-14-25)34(40)38(32)35(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-23,30H,24H2/t30-,36+/m0/s1 |
| InChIKey | KNCJWRRAPFOFHL-RYWJPUDZSA-N |
| XLogP | 7.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.06 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|