C37H37IN2O4S — CID 155935038
ethyl 2-[[(3S)-3-(tert-butylsulfinylamino)-5-iodo-2-oxo-1-tritylindol-3-yl]methyl]prop-2-enoate (PubChem CID 155935038) has the molecular formula C37H37IN2O4S and a molecular weight of 732.68 g/mol. Its IUPAC name is ethyl 2-[[(3S)-3-(tert-butylsulfinylamino)-5-iodo-2-oxo-1-tritylindol-3-yl]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[(3S)-3-(tert-butylsulfinylamino)-5-iodo-2-oxo-1-tritylindol-3-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 155935038 |
| Molecular Formula | C37H37IN2O4S |
| Molecular Weight | 732.68 g/mol |
| Exact Mass | 732.15 |
| IUPAC Name | ethyl 2-[[(3S)-3-(tert-butylsulfinylamino)-5-iodo-2-oxo-1-tritylindol-3-yl]methyl]prop-2-enoate |
| SMILES | C=C(C[C@@]1(NS(=O)C(C)(C)C)C(=O)N(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ccc(I)cc21)C(=O)OCC |
| InChI | InChI=1S/C37H37IN2O4S/c1-6-44-33(41)26(2)25-36(39-45(43)35(3,4)5)31-24-30(38)22-23-32(31)40(34(36)42)37(27-16-10-7-11-17-27,28-18-12-8-13-19-28)29-20-14-9-15-21-29/h7-24,39H,2,6,25H2,1,3-5H3/t36-,45?/m0/s1 |
| InChIKey | KTNXWDADJNVYEW-JVNLBVJRSA-N |
| XLogP | 7.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.68 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|