C23H16F3IN2O4 — CID 73212197
ethyl (2S,3S)-1'-benzyl-4-cyano-5'-iodo-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate (PubChem CID 73212197) has the molecular formula C23H16F3IN2O4 and a molecular weight of 568.29 g/mol. Its IUPAC name is ethyl (2S,3S)-1'-benzyl-4-cyano-5'-iodo-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate.
| Compound Name | ethyl (2S,3S)-1'-benzyl-4-cyano-5'-iodo-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate |
|---|---|
| PubChem CID | 73212197 |
| Molecular Formula | C23H16F3IN2O4 |
| Molecular Weight | 568.29 g/mol |
| Exact Mass | 568.01 |
| IUPAC Name | ethyl (2S,3S)-1'-benzyl-4-cyano-5'-iodo-2'-oxo-2-(trifluoromethyl)spiro[furan-3,3'-indole]-2-carboxylate |
| SMILES | CCOC(=O)[C@@]1(C(F)(F)F)OC=C(C#N)[C@]12C(=O)N(Cc1ccccc1)c1ccc(I)cc12 |
| InChI | InChI=1S/C23H16F3IN2O4/c1-2-32-20(31)22(23(24,25)26)21(15(11-28)13-33-22)17-10-16(27)8-9-18(17)29(19(21)30)12-14-6-4-3-5-7-14/h3-10,13H,2,12H2,1H3/t21-,22+/m0/s1 |
| InChIKey | OTZCCXQABAVPJM-FCHUYYIVSA-N |
| XLogP | 4.38 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|