C22H32O3S — CID 134848933
3-[(2S,6R)-6-methyl-3-(1-phenylsulfanylethenyl)oxan-2-yl]propyl 2,2-dimethylpropanoate (PubChem CID 134848933) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is 3-[(2S,6R)-6-methyl-3-(1-phenylsulfanylethenyl)oxan-2-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2S,6R)-6-methyl-3-(1-phenylsulfanylethenyl)oxan-2-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134848933 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[(2S,6R)-6-methyl-3-(1-phenylsulfanylethenyl)oxan-2-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C=C(Sc1ccccc1)C1CC[C@@H](C)O[C@H]1CCCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C22H32O3S/c1-16-13-14-19(17(2)26-18-10-7-6-8-11-18)20(25-16)12-9-15-24-21(23)22(3,4)5/h6-8,10-11,16,19-20H,2,9,12-15H2,1,3-5H3/t16-,19?,20+/m1/s1 |
| InChIKey | XXNCGPGCTZWATI-VBHUFULTSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|