C22H32O3S — CID 134848934
3-[(2R,5E,8S)-2-methyl-6-phenylsulfanyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propyl 2,2-dimethylpropanoate (PubChem CID 134848934) has the molecular formula C22H32O3S and a molecular weight of 376.56 g/mol. Its IUPAC name is 3-[(2R,5E,8S)-2-methyl-6-phenylsulfanyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(2R,5E,8S)-2-methyl-6-phenylsulfanyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134848934 |
| Molecular Formula | C22H32O3S |
| Molecular Weight | 376.56 g/mol |
| Exact Mass | 376.21 |
| IUPAC Name | 3-[(2R,5E,8S)-2-methyl-6-phenylsulfanyl-3,4,7,8-tetrahydro-2H-oxocin-8-yl]propyl 2,2-dimethylpropanoate |
| SMILES | C[C@@H]1CC/C=C(/Sc2ccccc2)C[C@H](CCCOC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C22H32O3S/c1-17-10-8-14-20(26-19-12-6-5-7-13-19)16-18(25-17)11-9-15-24-21(23)22(2,3)4/h5-7,12-14,17-18H,8-11,15-16H2,1-4H3/b20-14+/t17-,18+/m1/s1 |
| InChIKey | BWGUHTJJCRBYMQ-JXOOJWAFSA-N |
| XLogP | 5.99 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.56 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|