C19H27F2N5O5 — CID 134849760
8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-3,7-dimethyl-1-(5-oxohexyl)-4,5-dihydropurine-2,6-dione (PubChem CID 134849760) has the molecular formula C19H27F2N5O5 and a molecular weight of 443.45 g/mol. Its IUPAC name is 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-3,7-dimethyl-1-(5-oxohexyl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-3,7-dimethyl-1-(5-oxohexyl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 134849760 |
| Molecular Formula | C19H27F2N5O5 |
| Molecular Weight | 443.45 g/mol |
| Exact Mass | 443.20 |
| IUPAC Name | 8-(1,1-difluoro-2-morpholin-4-yl-2-oxoethyl)-3,7-dimethyl-1-(5-oxohexyl)-4,5-dihydropurine-2,6-dione |
| SMILES | CC(=O)CCCCN1C(=O)C2C(N=C(C(F)(F)C(=O)N3CCOCC3)N2C)N(C)C1=O |
| InChI | InChI=1S/C19H27F2N5O5/c1-12(27)6-4-5-7-26-15(28)13-14(24(3)18(26)30)22-16(23(13)2)19(20,21)17(29)25-8-10-31-11-9-25/h13-14H,4-11H2,1-3H3 |
| InChIKey | BAAVXBABHGLZDK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 102.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.45 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|