C18H30N5O3+ — CID 74690322
7-(2-ethoxyethyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione (PubChem CID 74690322) has the molecular formula C18H30N5O3+ and a molecular weight of 364.47 g/mol. Its IUPAC name is 7-(2-ethoxyethyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione.
| Compound Name | 7-(2-ethoxyethyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 74690322 |
| Molecular Formula | C18H30N5O3+ |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.23 |
| IUPAC Name | 7-(2-ethoxyethyl)-1,3-dimethyl-8-[(2-methylpiperidin-1-yl)methyl]-5H-purin-7-ium-2,6-dione |
| SMILES | CCOCC[N+]1=C(CN2CCCCC2C)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C18H30N5O3/c1-5-26-11-10-23-14(12-22-9-7-6-8-13(22)2)19-16-15(23)17(24)21(4)18(25)20(16)3/h13,15H,5-12H2,1-4H3/q+1 |
| InChIKey | SRNSECBLPZMIPU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 68.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|