C16H24N5O4+ — CID 78210865
1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione (PubChem CID 78210865) has the molecular formula C16H24N5O4+ and a molecular weight of 350.40 g/mol. Its IUPAC name is 1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione.
| Compound Name | 1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione |
|---|---|
| PubChem CID | 78210865 |
| Molecular Formula | C16H24N5O4+ |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1,3-dimethyl-8-(morpholin-4-ylmethyl)-7-(3-oxobutan-2-yl)-5H-purin-7-ium-2,6-dione |
| SMILES | CC(=O)C(C)[N+]1=C(CN2CCOCC2)N=C2C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C16H24N5O4/c1-10(11(2)22)21-12(9-20-5-7-25-8-6-20)17-14-13(21)15(23)19(4)16(24)18(14)3/h10,13H,5-9H2,1-4H3/q+1 |
| InChIKey | SIQWGYCLPGRVJA-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|