C16H27N7O4 — CID 73327412
2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetamide (PubChem CID 73327412) has the molecular formula C16H27N7O4 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetamide.
| Compound Name | 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 73327412 |
| Molecular Formula | C16H27N7O4 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[4-[7-(2-ethoxyethyl)-3-methyl-2,6-dioxo-4,5-dihydropurin-8-yl]piperazin-1-yl]acetamide |
| SMILES | CCOCCN1C(N2CCN(CC(N)=O)CC2)=NC2C1C(=O)NC(=O)N2C |
| InChI | InChI=1S/C16H27N7O4/c1-3-27-9-8-23-12-13(20(2)16(26)19-14(12)25)18-15(23)22-6-4-21(5-7-22)10-11(17)24/h12-13H,3-10H2,1-2H3,(H2,17,24)(H,19,25,26) |
| InChIKey | LWVVDTYGXVXQQX-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 123.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|