C17H24O6S — CID 134850671
[(2S,3S,4R,5R,6S)-3,5-dihydroxy-4-methyl-6-prop-2-enyloxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134850671) has the molecular formula C17H24O6S and a molecular weight of 356.44 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-3,5-dihydroxy-4-methyl-6-prop-2-enyloxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S,4R,5R,6S)-3,5-dihydroxy-4-methyl-6-prop-2-enyloxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134850671 |
| Molecular Formula | C17H24O6S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-3,5-dihydroxy-4-methyl-6-prop-2-enyloxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | C=CC[C@@H]1O[C@@H](COS(=O)(=O)c2ccc(C)cc2)[C@@H](O)[C@H](C)[C@H]1O |
| InChI | InChI=1S/C17H24O6S/c1-4-5-14-16(18)12(3)17(19)15(23-14)10-22-24(20,21)13-8-6-11(2)7-9-13/h4,6-9,12,14-19H,1,5,10H2,2-3H3/t12-,14+,15+,16-,17+/m1/s1 |
| InChIKey | SWFDZKDBFVMCNT-GWFJUFKTSA-N |
| XLogP | 1.40 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|