C27H22N2O2 — CID 134850885
methyl (E)-2,2-bis(1H-indol-3-yl)-4-phenylbut-3-enoate (PubChem CID 134850885) has the molecular formula C27H22N2O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is methyl (E)-2,2-bis(1H-indol-3-yl)-4-phenylbut-3-enoate.
| Compound Name | methyl (E)-2,2-bis(1H-indol-3-yl)-4-phenylbut-3-enoate |
|---|---|
| PubChem CID | 134850885 |
| Molecular Formula | C27H22N2O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | methyl (E)-2,2-bis(1H-indol-3-yl)-4-phenylbut-3-enoate |
| SMILES | COC(=O)C(/C=C/c1ccccc1)(c1c[nH]c2ccccc12)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C27H22N2O2/c1-31-26(30)27(16-15-19-9-3-2-4-10-19,22-17-28-24-13-7-5-11-20(22)24)23-18-29-25-14-8-6-12-21(23)25/h2-18,28-29H,1H3/b16-15+ |
| InChIKey | GZCWWGAMNOEQLZ-FOCLMDBBSA-N |
| XLogP | 5.82 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |