C30H30N2O4 — CID 134850930
benzyl N-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopent-3-en-1-yl]-N-(phenylmethoxycarbonylamino)carbamate (PubChem CID 134850930) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is benzyl N-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopent-3-en-1-yl]-N-(phenylmethoxycarbonylamino)carbamate.
| Compound Name | benzyl N-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopent-3-en-1-yl]-N-(phenylmethoxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 134850930 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | benzyl N-[(1R,2S)-2-[(E)-2-(4-methylphenyl)ethenyl]cyclopent-3-en-1-yl]-N-(phenylmethoxycarbonylamino)carbamate |
| SMILES | Cc1ccc(/C=C/[C@@H]2C=CC[C@H]2N(NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H30N2O4/c1-23-15-17-24(18-16-23)19-20-27-13-8-14-28(27)32(30(34)36-22-26-11-6-3-7-12-26)31-29(33)35-21-25-9-4-2-5-10-25/h2-13,15-20,27-28H,14,21-22H2,1H3,(H,31,33)/b20-19+/t27-,28+/m0/s1 |
| InChIKey | GQARKVQKNOTJCQ-BWCCCUOSSA-N |
| XLogP | 6.43 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|