C20H31O3Si+ — CID 134851041
1-[8-[tert-butyl(dimethyl)silyl]oxy-1,3,5,6,7,8-hexahydrocyclopenta[e][2]benzofuran-8b-ylium-5-yl]propan-2-one (PubChem CID 134851041) has the molecular formula C20H31O3Si+ and a molecular weight of 347.55 g/mol. Its IUPAC name is 1-[8-[tert-butyl(dimethyl)silyl]oxy-1,3,5,6,7,8-hexahydrocyclopenta[e][2]benzofuran-8b-ylium-5-yl]propan-2-one.
| Compound Name | 1-[8-[tert-butyl(dimethyl)silyl]oxy-1,3,5,6,7,8-hexahydrocyclopenta[e][2]benzofuran-8b-ylium-5-yl]propan-2-one |
|---|---|
| PubChem CID | 134851041 |
| Molecular Formula | C20H31O3Si+ |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.20 |
| IUPAC Name | 1-[8-[tert-butyl(dimethyl)silyl]oxy-1,3,5,6,7,8-hexahydrocyclopenta[e][2]benzofuran-8b-ylium-5-yl]propan-2-one |
| SMILES | CC(=O)CC1C=C2COC[C+]2C2=C1CCC2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H31O3Si/c1-13(21)9-14-10-15-11-22-12-17(15)19-16(14)7-8-18(19)23-24(5,6)20(2,3)4/h10,14,18H,7-9,11-12H2,1-6H3/q+1 |
| InChIKey | LWIIBUIVCJIYON-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|