About N-butan-2-ylmethanimine;yttrium
N-butan-2-ylmethanimine;yttrium (PubChem CID 134851692) has the molecular formula C5H9NY-2
and a molecular weight of 172.04 g/mol. Its IUPAC name is N-butan-2-ylmethanimine;yttrium.
Molecular Properties
| Compound Name | N-butan-2-ylmethanimine;yttrium |
| PubChem CID | 134851692 |
| Molecular Formula | C5H9NY-2 |
| Molecular Weight | 172.04 g/mol |
| Exact Mass | 171.98 |
| IUPAC Name | N-butan-2-ylmethanimine;yttrium |
| SMILES | [H]/[C-]=N/C(C)[CH-]C.[Y] |
| InChI | InChI=1S/C5H9N.Y/c1-4-5(2)6-3;/h3-5H,1-2H3;/q-2; |
| InChIKey | XQIYJWRZXWXPBC-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.04 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylmethanimine;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylmethanimine;yttrium?
The IUPAC name of N-butan-2-ylmethanimine;yttrium (CID 134851692) is N-butan-2-ylmethanimine;yttrium.
What is the SMILES notation for N-butan-2-ylmethanimine;yttrium?
The canonical SMILES for N-butan-2-ylmethanimine;yttrium is [H]/[C-]=N/C(C)[CH-]C.[Y].
What is the InChIKey of N-butan-2-ylmethanimine;yttrium?
The InChIKey is XQIYJWRZXWXPBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N.Y/c1-4-5(2)6-3;/h3-5H,1-2H3;/q-2;.
What are the key properties of N-butan-2-ylmethanimine;yttrium?
N-butan-2-ylmethanimine;yttrium has a molecular weight of 172.04 g/mol, XLogP of 1.17, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylmethanimine;yttrium is sourced from PubChem (CID 134851692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).