About N-pentan-3-ylmethanimine
N-pentan-3-ylmethanimine (PubChem CID 123798612) has the molecular formula C6H13N
and a molecular weight of 99.18 g/mol. Its IUPAC name is N-pentan-3-ylmethanimine.
Molecular Properties
| Compound Name | N-pentan-3-ylmethanimine |
| PubChem CID | 123798612 |
| Molecular Formula | C6H13N |
| Molecular Weight | 99.18 g/mol |
| Exact Mass | 99.10 |
| IUPAC Name | N-pentan-3-ylmethanimine |
| SMILES | C=NC(CC)CC |
| InChI | InChI=1S/C6H13N/c1-4-6(5-2)7-3/h6H,3-5H2,1-2H3 |
| InChIKey | JQGTUBOVBYKKQQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.18 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-pentan-3-ylmethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-pentan-3-ylmethanimine?
The IUPAC name of N-pentan-3-ylmethanimine (CID 123798612) is N-pentan-3-ylmethanimine.
What is the SMILES notation for N-pentan-3-ylmethanimine?
The canonical SMILES for N-pentan-3-ylmethanimine is C=NC(CC)CC.
What is the InChIKey of N-pentan-3-ylmethanimine?
The InChIKey is JQGTUBOVBYKKQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N/c1-4-6(5-2)7-3/h6H,3-5H2,1-2H3.
What are the key properties of N-pentan-3-ylmethanimine?
N-pentan-3-ylmethanimine has a molecular weight of 99.18 g/mol, XLogP of 1.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-pentan-3-ylmethanimine is sourced from PubChem (CID 123798612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).