C18H17FeN2S — CID 134851739
carbanide;(3Z)-3-[(2Z)-2-cyclopenta-2,4-dien-1-ylideneethylidene]-5-methylsulfanyl-1-phenylpyrazol-2-ide;iron(3+) (PubChem CID 134851739) has the molecular formula C18H17FeN2S and a molecular weight of 349.26 g/mol. Its IUPAC name is carbanide;(3Z)-3-[(2Z)-2-cyclopenta-2,4-dien-1-ylideneethylidene]-5-methylsulfanyl-1-phenylpyrazol-2-ide;iron(3+).
| Compound Name | carbanide;(3Z)-3-[(2Z)-2-cyclopenta-2,4-dien-1-ylideneethylidene]-5-methylsulfanyl-1-phenylpyrazol-2-ide;iron(3+) |
|---|---|
| PubChem CID | 134851739 |
| Molecular Formula | C18H17FeN2S |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | carbanide;(3Z)-3-[(2Z)-2-cyclopenta-2,4-dien-1-ylideneethylidene]-5-methylsulfanyl-1-phenylpyrazol-2-ide;iron(3+) |
| SMILES | CSC1=C/C(=C/C=C2/[C-]=CC=C2)[N-]N1c1ccccc1.[CH3-].[Fe+3] |
| InChI | InChI=1S/C17H14N2S.CH3.Fe/c1-20-17-13-15(12-11-14-7-5-6-8-14)18-19(17)16-9-3-2-4-10-16;;/h2-7,9-13H,1H3;1H3;/q-2;-1;+3/b14-11+,15-12-;; |
| InChIKey | UPRIGTALFSZRIS-WJDDKIIPSA-N |
| XLogP | 5.19 |
| TPSA | 17.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|