C22H23N3S2 — CID 12840667
3-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl)sulfanylpropanenitrile (PubChem CID 12840667) has the molecular formula C22H23N3S2 and a molecular weight of 393.58 g/mol. Its IUPAC name is 3-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl)sulfanylpropanenitrile.
| Compound Name | 3-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 12840667 |
| Molecular Formula | C22H23N3S2 |
| Molecular Weight | 393.58 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl)sulfanylpropanenitrile |
| SMILES | CCCCc1c(SCCC#N)n(-c2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C22H23N3S2/c1-2-3-15-20-21(26)24(18-11-6-4-7-12-18)25(19-13-8-5-9-14-19)22(20)27-17-10-16-23/h4-9,11-14H,2-3,10,15,17H2,1H3 |
| InChIKey | YNUQWXZPZHJZHS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.58 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|