C11H8FN3S3 — CID 7528787
(2S)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile (PubChem CID 7528787) has the molecular formula C11H8FN3S3 and a molecular weight of 297.41 g/mol. Its IUPAC name is (2S)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile.
| Compound Name | (2S)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile |
|---|---|
| PubChem CID | 7528787 |
| Molecular Formula | C11H8FN3S3 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 296.99 |
| IUPAC Name | (2S)-2-[[4-(4-fluorophenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]propanenitrile |
| SMILES | C[C@@H](C#N)Sc1nn(-c2ccc(F)cc2)c(=S)s1 |
| InChI | InChI=1S/C11H8FN3S3/c1-7(6-13)17-10-14-15(11(16)18-10)9-4-2-8(12)3-5-9/h2-5,7H,1H3/t7-/m0/s1 |
| InChIKey | VPHSJTWOKZTXRR-ZETCQYMHSA-N |
| XLogP | 3.81 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|