C21H22N2OS2 — CID 5260484
S-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl) ethanethioate (PubChem CID 5260484) has the molecular formula C21H22N2OS2 and a molecular weight of 382.55 g/mol. Its IUPAC name is S-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl) ethanethioate.
| Compound Name | S-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl) ethanethioate |
|---|---|
| PubChem CID | 5260484 |
| Molecular Formula | C21H22N2OS2 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | S-(4-butyl-1,2-diphenyl-5-sulfanylidenepyrazol-3-yl) ethanethioate |
| SMILES | CCCCc1c(SC(C)=O)n(-c2ccccc2)n(-c2ccccc2)c1=S |
| InChI | InChI=1S/C21H22N2OS2/c1-3-4-15-19-20(25)22(17-11-7-5-8-12-17)23(21(19)26-16(2)24)18-13-9-6-10-14-18/h5-14H,3-4,15H2,1-2H3 |
| InChIKey | WOFHQXOHUNSJMQ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|