C15H17NS4 — CID 134908433
4,6-dimethyl-3,7-bis(methylsulfanyl)-8-phenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 134908433) has the molecular formula C15H17NS4 and a molecular weight of 339.58 g/mol. Its IUPAC name is 4,6-dimethyl-3,7-bis(methylsulfanyl)-8-phenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 4,6-dimethyl-3,7-bis(methylsulfanyl)-8-phenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 134908433 |
| Molecular Formula | C15H17NS4 |
| Molecular Weight | 339.58 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 4,6-dimethyl-3,7-bis(methylsulfanyl)-8-phenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | CSC1=C(C)C2=S(S1)N(c1ccccc1)C(SC)=C2C |
| InChI | InChI=1S/C15H17NS4/c1-10-13-11(2)15(18-4)19-20(13)16(14(10)17-3)12-8-6-5-7-9-12/h5-9H,1-4H3 |
| InChIKey | KHQYWYDDXUUJIF-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.58 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|