C20H19NS4 — CID 134908764
6-methyl-3,7-bis(methylsulfanyl)-4,8-diphenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 134908764) has the molecular formula C20H19NS4 and a molecular weight of 401.65 g/mol. Its IUPAC name is 6-methyl-3,7-bis(methylsulfanyl)-4,8-diphenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 6-methyl-3,7-bis(methylsulfanyl)-4,8-diphenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 134908764 |
| Molecular Formula | C20H19NS4 |
| Molecular Weight | 401.65 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 6-methyl-3,7-bis(methylsulfanyl)-4,8-diphenyl-1λ4,2-dithia-8-azabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | CSC1=C(c2ccccc2)C2=S(S1)N(c1ccccc1)C(SC)=C2C |
| InChI | InChI=1S/C20H19NS4/c1-14-18-17(15-10-6-4-7-11-15)20(23-3)24-25(18)21(19(14)22-2)16-12-8-5-9-13-16/h4-13H,1-3H3 |
| InChIKey | VEUUVRWKWPGNGL-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.65 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|