C11H12O6 — CID 134851988
methyl (5Z)-5-[hydroxy(methoxy)methylidene]-6a-methylfuro[2,3-b]furan-4-carboxylate (PubChem CID 134851988) has the molecular formula C11H12O6 and a molecular weight of 240.21 g/mol. Its IUPAC name is methyl (5Z)-5-[hydroxy(methoxy)methylidene]-6a-methylfuro[2,3-b]furan-4-carboxylate.
| Compound Name | methyl (5Z)-5-[hydroxy(methoxy)methylidene]-6a-methylfuro[2,3-b]furan-4-carboxylate |
|---|---|
| PubChem CID | 134851988 |
| Molecular Formula | C11H12O6 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl (5Z)-5-[hydroxy(methoxy)methylidene]-6a-methylfuro[2,3-b]furan-4-carboxylate |
| SMILES | COC(=O)C1=C2C=COC2(C)O/C1=C(/O)OC |
| InChI | InChI=1S/C11H12O6/c1-11-6(4-5-16-11)7(9(12)14-2)8(17-11)10(13)15-3/h4-5,13H,1-3H3/b10-8- |
| InChIKey | NHJYSKSQXUMJMR-NTMALXAHSA-N |
| XLogP | 1.12 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|