C20H21NO2 — CID 134852875
5-hydroxy-3,5-dimethyl-4-phenyl-1-(2-phenylethyl)pyrrol-2-one (PubChem CID 134852875) has the molecular formula C20H21NO2 and a molecular weight of 307.39 g/mol. Its IUPAC name is 5-hydroxy-3,5-dimethyl-4-phenyl-1-(2-phenylethyl)pyrrol-2-one.
| Compound Name | 5-hydroxy-3,5-dimethyl-4-phenyl-1-(2-phenylethyl)pyrrol-2-one |
|---|---|
| PubChem CID | 134852875 |
| Molecular Formula | C20H21NO2 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | 5-hydroxy-3,5-dimethyl-4-phenyl-1-(2-phenylethyl)pyrrol-2-one |
| SMILES | CC1=C(c2ccccc2)C(C)(O)N(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C20H21NO2/c1-15-18(17-11-7-4-8-12-17)20(2,23)21(19(15)22)14-13-16-9-5-3-6-10-16/h3-12,23H,13-14H2,1-2H3 |
| InChIKey | XOMQVDXXLMWQOL-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |