C15H21NO6 — CID 134852945
(3S,6S)-2-methyl-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol (PubChem CID 134852945) has the molecular formula C15H21NO6 and a molecular weight of 311.33 g/mol. Its IUPAC name is (3S,6S)-2-methyl-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol.
| Compound Name | (3S,6S)-2-methyl-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 134852945 |
| Molecular Formula | C15H21NO6 |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (3S,6S)-2-methyl-6-(2-phenylmethoxyiminoethoxy)oxane-3,4,5-triol |
| SMILES | CC1O[C@H](OCC=NOCc2ccccc2)C(O)C(O)[C@@H]1O |
| InChI | InChI=1S/C15H21NO6/c1-10-12(17)13(18)14(19)15(22-10)20-8-7-16-21-9-11-5-3-2-4-6-11/h2-7,10,12-15,17-19H,8-9H2,1H3/t10?,12-,13?,14?,15+/m1/s1 |
| InChIKey | MJJWNRBOZQMFDM-KWYAVZEISA-N |
| XLogP | 0.03 |
| TPSA | 100.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|