C17H34O5 — CID 134853342
(2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-ol (PubChem CID 134853342) has the molecular formula C17H34O5 and a molecular weight of 318.45 g/mol. Its IUPAC name is (2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-ol.
| Compound Name | (2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-ol |
|---|---|
| PubChem CID | 134853342 |
| Molecular Formula | C17H34O5 |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (2S,8S,11S)-8,11-bis(methoxymethoxy)tridec-12-en-2-ol |
| SMILES | C=C[C@H](CC[C@H](CCCCC[C@H](C)O)OCOC)OCOC |
| InChI | InChI=1S/C17H34O5/c1-5-16(21-13-19-3)11-12-17(22-14-20-4)10-8-6-7-9-15(2)18/h5,15-18H,1,6-14H2,2-4H3/t15-,16+,17-/m0/s1 |
| InChIKey | MHGDEIFBJIZDLH-BBWFWOEESA-N |
| XLogP | 3.26 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|