About 14,14-dimethoxytetradec-1-en-3-ol
14,14-dimethoxytetradec-1-en-3-ol (PubChem CID 11425770) has the molecular formula C16H32O3
and a molecular weight of 272.43 g/mol. Its IUPAC name is 14,14-dimethoxytetradec-1-en-3-ol.
Molecular Properties
| Compound Name | 14,14-dimethoxytetradec-1-en-3-ol |
| PubChem CID | 11425770 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 14,14-dimethoxytetradec-1-en-3-ol |
| SMILES | C=CC(O)CCCCCCCCCCC(OC)OC |
| InChI | InChI=1S/C16H32O3/c1-4-15(17)13-11-9-7-5-6-8-10-12-14-16(18-2)19-3/h4,15-17H,1,5-14H2,2-3H3 |
| InChIKey | NJTIZWNWZRFAKR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 14,14-dimethoxytetradec-1-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 14,14-dimethoxytetradec-1-en-3-ol?
The IUPAC name of 14,14-dimethoxytetradec-1-en-3-ol (CID 11425770) is 14,14-dimethoxytetradec-1-en-3-ol.
What is the SMILES notation for 14,14-dimethoxytetradec-1-en-3-ol?
The canonical SMILES for 14,14-dimethoxytetradec-1-en-3-ol is C=CC(O)CCCCCCCCCCC(OC)OC.
What is the InChIKey of 14,14-dimethoxytetradec-1-en-3-ol?
The InChIKey is NJTIZWNWZRFAKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O3/c1-4-15(17)13-11-9-7-5-6-8-10-12-14-16(18-2)19-3/h4,15-17H,1,5-14H2,2-3H3.
What are the key properties of 14,14-dimethoxytetradec-1-en-3-ol?
14,14-dimethoxytetradec-1-en-3-ol has a molecular weight of 272.43 g/mol, XLogP of 4.05, 14 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 14,14-dimethoxytetradec-1-en-3-ol is sourced from PubChem (CID 11425770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).