C46H50O8 — CID 134853752
(2R,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5,6-pentakis(phenylmethoxy)hexanal (PubChem CID 134853752) has the molecular formula C46H50O8 and a molecular weight of 730.90 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5,6-pentakis(phenylmethoxy)hexanal.
| Compound Name | (2R,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5,6-pentakis(phenylmethoxy)hexanal |
|---|---|
| PubChem CID | 134853752 |
| Molecular Formula | C46H50O8 |
| Molecular Weight | 730.90 g/mol |
| Exact Mass | 730.35 |
| IUPAC Name | (2R,3R,4R,5R,6R)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,3,4,5,6-pentakis(phenylmethoxy)hexanal |
| SMILES | CC1(C)OC[C@H]([C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](C=O)OCc2ccccc2)O1 |
| InChI | InChI=1S/C46H50O8/c1-46(2)53-34-41(54-46)43(50-31-37-22-12-5-13-23-37)45(52-33-39-26-16-7-17-27-39)44(51-32-38-24-14-6-15-25-38)42(49-30-36-20-10-4-11-21-36)40(28-47)48-29-35-18-8-3-9-19-35/h3-28,40-45H,29-34H2,1-2H3/t40-,41+,42-,43+,44-,45+/m0/s1 |
| InChIKey | ZAUKSQBAPSYCIU-DEQJLZAJSA-N |
| XLogP | 8.26 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.90 |
| LogP ≤ 5 | 8.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|