C22H36N3O6P — CID 134853856
[(1S,2R)-1-[[1-[(2S)-2-(cyclopentanecarbonylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropyl]phosphonic acid (PubChem CID 134853856) has the molecular formula C22H36N3O6P and a molecular weight of 469.52 g/mol. Its IUPAC name is [(1S,2R)-1-[[1-[(2S)-2-(cyclopentanecarbonylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropyl]phosphonic acid.
| Compound Name | [(1S,2R)-1-[[1-[(2S)-2-(cyclopentanecarbonylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropyl]phosphonic acid |
|---|---|
| PubChem CID | 134853856 |
| Molecular Formula | C22H36N3O6P |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | [(1S,2R)-1-[[1-[(2S)-2-(cyclopentanecarbonylamino)-3,3-dimethylbutanoyl]pyrrolidine-2-carbonyl]amino]-2-ethenylcyclopropyl]phosphonic acid |
| SMILES | C=C[C@H]1C[C@]1(NC(=O)C1CCCN1C(=O)[C@@H](NC(=O)C1CCCC1)C(C)(C)C)P(=O)(O)O |
| InChI | InChI=1S/C22H36N3O6P/c1-5-15-13-22(15,32(29,30)31)24-19(27)16-11-8-12-25(16)20(28)17(21(2,3)4)23-18(26)14-9-6-7-10-14/h5,14-17H,1,6-13H2,2-4H3,(H,23,26)(H,24,27)(H2,29,30,31)/t15-,16?,17+,22-/m0/s1 |
| InChIKey | MEHOZQBBKXVPIX-KFKNTXKTSA-N |
| XLogP | 1.89 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|