C13H15FINO4 — CID 134854456
ethyl N-[4-fluoro-2-(4-hydroxy-2-iodobutanoyl)phenyl]carbamate (PubChem CID 134854456) has the molecular formula C13H15FINO4 and a molecular weight of 395.17 g/mol. Its IUPAC name is ethyl N-[4-fluoro-2-(4-hydroxy-2-iodobutanoyl)phenyl]carbamate.
| Compound Name | ethyl N-[4-fluoro-2-(4-hydroxy-2-iodobutanoyl)phenyl]carbamate |
|---|---|
| PubChem CID | 134854456 |
| Molecular Formula | C13H15FINO4 |
| Molecular Weight | 395.17 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | ethyl N-[4-fluoro-2-(4-hydroxy-2-iodobutanoyl)phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(F)cc1C(=O)C(I)CCO |
| InChI | InChI=1S/C13H15FINO4/c1-2-20-13(19)16-11-4-3-8(14)7-9(11)12(18)10(15)5-6-17/h3-4,7,10,17H,2,5-6H2,1H3,(H,16,19) |
| InChIKey | LEKMZWBMVHULQQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|