C7H12O2S — CID 134854591
(5S)-3,4-dimethyl-5-(sulfanylmethyl)oxolan-2-one (PubChem CID 134854591) has the molecular formula C7H12O2S and a molecular weight of 160.24 g/mol. Its IUPAC name is (5S)-3,4-dimethyl-5-(sulfanylmethyl)oxolan-2-one.
| Compound Name | (5S)-3,4-dimethyl-5-(sulfanylmethyl)oxolan-2-one |
|---|---|
| PubChem CID | 134854591 |
| Molecular Formula | C7H12O2S |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.06 |
| IUPAC Name | (5S)-3,4-dimethyl-5-(sulfanylmethyl)oxolan-2-one |
| SMILES | CC1C(=O)O[C@H](CS)C1C |
| InChI | InChI=1S/C7H12O2S/c1-4-5(2)7(8)9-6(4)3-10/h4-6,10H,3H2,1-2H3/t4?,5?,6-/m1/s1 |
| InChIKey | JGIBMZDJBJNLSS-JMMWHDCWSA-N |
| XLogP | 1.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|