C7H12O2S2 — CID 19096332
4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one (PubChem CID 19096332) has the molecular formula C7H12O2S2 and a molecular weight of 192.30 g/mol. Its IUPAC name is 4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one.
| Compound Name | 4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one |
|---|---|
| PubChem CID | 19096332 |
| Molecular Formula | C7H12O2S2 |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 4-methyl-3,5-bis(sulfanylmethyl)oxolan-2-one |
| SMILES | CC1C(CS)OC(=O)C1CS |
| InChI | InChI=1S/C7H12O2S2/c1-4-5(2-10)7(8)9-6(4)3-11/h4-6,10-11H,2-3H2,1H3 |
| InChIKey | KQQITFMEXDIACJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|