C17H32O2 — CID 134854836
(4S)-2-tert-butyl-4-hexyl-6-prop-2-enyl-1,3-dioxane (PubChem CID 134854836) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (4S)-2-tert-butyl-4-hexyl-6-prop-2-enyl-1,3-dioxane.
| Compound Name | (4S)-2-tert-butyl-4-hexyl-6-prop-2-enyl-1,3-dioxane |
|---|---|
| PubChem CID | 134854836 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (4S)-2-tert-butyl-4-hexyl-6-prop-2-enyl-1,3-dioxane |
| SMILES | C=CCC1C[C@H](CCCCCC)OC(C(C)(C)C)O1 |
| InChI | InChI=1S/C17H32O2/c1-6-8-9-10-12-15-13-14(11-7-2)18-16(19-15)17(3,4)5/h7,14-16H,2,6,8-13H2,1,3-5H3/t14?,15-,16?/m0/s1 |
| InChIKey | ZFXVYDWTQXWKRB-PCKAHOCUSA-N |
| XLogP | 5.08 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|